| p-Fluorotoluene | |
| Product name | p-Fluorotoluene |
| CAS NO | 352-32-9 |
| Molecular weight | 110.1289 |
| EC NO. | 206-520-6 |
| Molecular formula | C7H7F |
| InChI | InChI=1/C7H7F/c1-6-2-4-7(8)5-3-6/h2-5H,1H3 |
| Physicochemical properties | Molecular weight:110.13 |
| Appearance | |
| Property | |
| Quality indexes | |
| Uses | Used as the intermediate of synthesis of pharmaceuticals, pesticides and other fine chemicals |
| Packing | Galvanized metal pail, net weight: 200kg. Stored in a ventilated, cool place. |