| m-Fluorotoluene | |
| Product name | m-Fluorotoluene |
| CAS NO | 352-70-5 |
| Molecular weight | 110.1289 |
| EC NO. | 206-524-8 |
| Molecular formula | C7H7F |
| InChI | InChI=1/C7H7F/c1-6-3-2-4-7(8)5-6/h2-5H,1H3 |
| Physicochemical properties | Appearance:Colorless,transparent liquid |
| Appearance | |
| Property | |
| Quality indexes | |
| Uses | This product is an intermediate for the synthesis of medicines, pesticides and other fine chemical products . |
| Packing | Galvanized metal pail, net weight: 200kg. Stored in a ventilated, cool place. |